| Name | 2-methyl-2-vinyloxirane |
| Synonyms | ISOPRENE MONOXIDE 2-methyl-2-vinyloxirane 2-METHYL-2-VINYLOXIRANE 2-Ethenyl-2-methyloxirane 3,4-epoxy-3-methyl-1-butene Oxirane,2-ethenyl-2-methyl- 1-Butene,3,4-epoxy-3-methyl- (R,S)-2-Methyl-2-vinyl-oxirane 2-Methyl-2-vinyloxacyclopropane |
| CAS | 1838-94-4 |
| EINECS | 628-136-1 |
| InChI | InChI=1/C5H8O/c1-3-5(2)4-6-5/h3H,1,4H2,2H3 |
| Molecular Formula | C5H8O |
| Molar Mass | 84.12 |
| Density | 0.857g/mLat 25°C(lit.) |
| Boling Point | 79.5-80.5°C(lit.) |
| Flash Point | 18°F |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 102mmHg at 25°C |
| Appearance | Liquid |
| Color | Colorless |
| BRN | 104216 |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.416(lit.) |
| Risk Codes | R11 - Highly Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Class | 3 |
| Packing Group | II |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |